C12H15NO5 — CID 117385433
3-amino-3-(4-formyl-2,3-dimethoxyphenyl)propanoic acid (PubChem CID 117385433) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-amino-3-(4-formyl-2,3-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(4-formyl-2,3-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117385433 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-amino-3-(4-formyl-2,3-dimethoxyphenyl)propanoic acid |
| SMILES | COc1c(C=O)ccc(C(N)CC(=O)O)c1OC |
| InChI | InChI=1S/C12H15NO5/c1-17-11-7(6-14)3-4-8(12(11)18-2)9(13)5-10(15)16/h3-4,6,9H,5,13H2,1-2H3,(H,15,16) |
| InChIKey | LFVWVKIODNIGOZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|