C11H13NO5 — CID 117350252
2-amino-2-(4-formyl-2,3-dimethoxyphenyl)acetic acid (PubChem CID 117350252) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-amino-2-(4-formyl-2,3-dimethoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(4-formyl-2,3-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117350252 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-amino-2-(4-formyl-2,3-dimethoxyphenyl)acetic acid |
| SMILES | COc1c(C=O)ccc(C(N)C(=O)O)c1OC |
| InChI | InChI=1S/C11H13NO5/c1-16-9-6(5-13)3-4-7(10(9)17-2)8(12)11(14)15/h3-5,8H,12H2,1-2H3,(H,14,15) |
| InChIKey | KISYSQWCJZIGAQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|