C11H14FNO3 — CID 84691082
2-amino-2-[3-(1-fluoroethyl)-2-methoxyphenyl]acetic acid (PubChem CID 84691082) has the molecular formula C11H14FNO3 and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-amino-2-[3-(1-fluoroethyl)-2-methoxyphenyl]acetic acid.
| Compound Name | 2-amino-2-[3-(1-fluoroethyl)-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 84691082 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-amino-2-[3-(1-fluoroethyl)-2-methoxyphenyl]acetic acid |
| SMILES | COc1c(C(C)F)cccc1C(N)C(=O)O |
| InChI | InChI=1S/C11H14FNO3/c1-6(12)7-4-3-5-8(10(7)16-2)9(13)11(14)15/h3-6,9H,13H2,1-2H3,(H,14,15) |
| InChIKey | DJPMWRXPFAEELF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |