C11H14ClNO2 — CID 84791799
3-amino-3-(3-chloro-2,4-dimethylphenyl)propanoic acid (PubChem CID 84791799) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-amino-3-(3-chloro-2,4-dimethylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(3-chloro-2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 84791799 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-amino-3-(3-chloro-2,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C(N)CC(=O)O)c(C)c1Cl |
| InChI | InChI=1S/C11H14ClNO2/c1-6-3-4-8(7(2)11(6)12)9(13)5-10(14)15/h3-4,9H,5,13H2,1-2H3,(H,14,15) |
| InChIKey | XRDNXABSHXTCAK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |