3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid

C10H14N2O2 — CID 55296014

IUPAC3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid
SMILESCc1ccc(C(N)CC(=O)O)c(C)n1
InChIInChI=1S/C10H14N2O2/c1-6-3-4-8(7(2)12-6)9(11)5-10(13)14/h3-4,9H,5,11H2,1-2H3,(H,13,14)
InChIKeyRIJIMGUSLQZAMB-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.17
Rot. Bonds3

About 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid

3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid (PubChem CID 55296014) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid.

Molecular Properties

Compound Name3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid
PubChem CID55296014
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid
SMILESCc1ccc(C(N)CC(=O)O)c(C)n1
InChIInChI=1S/C10H14N2O2/c1-6-3-4-8(7(2)12-6)9(11)5-10(13)14/h3-4,9H,5,11H2,1-2H3,(H,13,14)
InChIKeyRIJIMGUSLQZAMB-UHFFFAOYSA-N
XLogP1.17
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid?
The IUPAC name of 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid (CID 55296014) is 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid.
What is the SMILES notation for 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid?
The canonical SMILES for 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid is Cc1ccc(C(N)CC(=O)O)c(C)n1.
What is the InChIKey of 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid?
The InChIKey is RIJIMGUSLQZAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-6-3-4-8(7(2)12-6)9(11)5-10(13)14/h3-4,9H,5,11H2,1-2H3,(H,13,14).
What are the key properties of 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid?
3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid has a molecular weight of 194.23 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,6-dimethyl-3-pyridinyl)propanoic acid is sourced from PubChem (CID 55296014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).