C10H16N2O — CID 55292437
(1R,2S)-1-amino-1-(2,6-dimethyl-3-pyridinyl)propan-2-ol (PubChem CID 55292437) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,6-dimethyl-3-pyridinyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,6-dimethyl-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 55292437 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,6-dimethyl-3-pyridinyl)propan-2-ol |
| SMILES | Cc1ccc([C@@H](N)[C@H](C)O)c(C)n1 |
| InChI | InChI=1S/C10H16N2O/c1-6-4-5-9(7(2)12-6)10(11)8(3)13/h4-5,8,10,13H,11H2,1-3H3/t8-,10-/m0/s1 |
| InChIKey | HXFQSQFFKZNXJG-WPRPVWTQSA-N |
| XLogP | 1.08 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |