C11H16N2 — CID 55262974
(R)-cyclopropyl-(2,6-dimethyl-3-pyridinyl)methanamine (PubChem CID 55262974) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (R)-cyclopropyl-(2,6-dimethyl-3-pyridinyl)methanamine.
| Compound Name | (R)-cyclopropyl-(2,6-dimethyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 55262974 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (R)-cyclopropyl-(2,6-dimethyl-3-pyridinyl)methanamine |
| SMILES | Cc1ccc([C@H](N)C2CC2)c(C)n1 |
| InChI | InChI=1S/C11H16N2/c1-7-3-6-10(8(2)13-7)11(12)9-4-5-9/h3,6,9,11H,4-5,12H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZPJFJHVWVMVRRP-LLVKDONJSA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |