C11H14ClN — CID 55268482
(2-chloro-4-methylphenyl)-cyclopropylmethanamine (PubChem CID 55268482) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl)-cyclopropylmethanamine.
| Compound Name | (2-chloro-4-methylphenyl)-cyclopropylmethanamine |
|---|---|
| PubChem CID | 55268482 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (2-chloro-4-methylphenyl)-cyclopropylmethanamine |
| SMILES | Cc1ccc(C(N)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN/c1-7-2-5-9(10(12)6-7)11(13)8-3-4-8/h2,5-6,8,11H,3-4,13H2,1H3 |
| InChIKey | YAWOONPFLJNJAB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |