C12H19N3 — CID 105340078
[cyclobutyl-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine (PubChem CID 105340078) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is [cyclobutyl-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | [cyclobutyl-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105340078 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | [cyclobutyl-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)C2CCC2)c(C)n1 |
| InChI | InChI=1S/C12H19N3/c1-8-6-7-11(9(2)14-8)12(15-13)10-4-3-5-10/h6-7,10,12,15H,3-5,13H2,1-2H3 |
| InChIKey | IXSPBVPZEUNTQU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|