C11H19N3 — CID 105281666
[1-(2,6-dimethyl-3-pyridinyl)-2-methylpropyl]hydrazine (PubChem CID 105281666) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is [1-(2,6-dimethyl-3-pyridinyl)-2-methylpropyl]hydrazine.
| Compound Name | [1-(2,6-dimethyl-3-pyridinyl)-2-methylpropyl]hydrazine |
|---|---|
| PubChem CID | 105281666 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [1-(2,6-dimethyl-3-pyridinyl)-2-methylpropyl]hydrazine |
| SMILES | Cc1ccc(C(NN)C(C)C)c(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-7(2)11(14-12)10-6-5-8(3)13-9(10)4/h5-7,11,14H,12H2,1-4H3 |
| InChIKey | PUEROSCBALXIRU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|