C12H15N3S — CID 105287512
[(2,6-dimethyl-3-pyridinyl)-thiophen-2-ylmethyl]hydrazine (PubChem CID 105287512) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is [(2,6-dimethyl-3-pyridinyl)-thiophen-2-ylmethyl]hydrazine.
| Compound Name | [(2,6-dimethyl-3-pyridinyl)-thiophen-2-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105287512 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [(2,6-dimethyl-3-pyridinyl)-thiophen-2-ylmethyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cccs2)c(C)n1 |
| InChI | InChI=1S/C12H15N3S/c1-8-5-6-10(9(2)14-8)12(15-13)11-4-3-7-16-11/h3-7,12,15H,13H2,1-2H3 |
| InChIKey | PTYBMUQIMHAXBT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|