C18H23N3 — CID 105341962
[(3-cyclobutylphenyl)-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine (PubChem CID 105341962) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is [(3-cyclobutylphenyl)-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-cyclobutylphenyl)-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341962 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | [(3-cyclobutylphenyl)-(2,6-dimethyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cccc(C3CCC3)c2)c(C)n1 |
| InChI | InChI=1S/C18H23N3/c1-12-9-10-17(13(2)20-12)18(21-19)16-8-4-7-15(11-16)14-5-3-6-14/h4,7-11,14,18,21H,3,5-6,19H2,1-2H3 |
| InChIKey | GDMVRFIMESOONX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|