C17H20BrN3 — CID 105263441
4-bromo-2-[(3-cyclobutylphenyl)-hydrazinylmethyl]aniline (PubChem CID 105263441) has the molecular formula C17H20BrN3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 4-bromo-2-[(3-cyclobutylphenyl)-hydrazinylmethyl]aniline.
| Compound Name | 4-bromo-2-[(3-cyclobutylphenyl)-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105263441 |
| Molecular Formula | C17H20BrN3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-bromo-2-[(3-cyclobutylphenyl)-hydrazinylmethyl]aniline |
| SMILES | NNC(c1cccc(C2CCC2)c1)c1cc(Br)ccc1N |
| InChI | InChI=1S/C17H20BrN3/c18-14-7-8-16(19)15(10-14)17(21-20)13-6-2-5-12(9-13)11-3-1-4-11/h2,5-11,17,21H,1,3-4,19-20H2 |
| InChIKey | UHVGXWIFYRUALC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|