C15H16Br2N2S — CID 105342056
[(3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methyl]hydrazine (PubChem CID 105342056) has the molecular formula C15H16Br2N2S and a molecular weight of 416.18 g/mol. Its IUPAC name is [(3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methyl]hydrazine.
| Compound Name | [(3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105342056 |
| Molecular Formula | C15H16Br2N2S |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | [(3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cccc(C2CCC2)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H16Br2N2S/c16-12-8-13(20-15(12)17)14(19-18)11-6-2-5-10(7-11)9-3-1-4-9/h2,5-9,14,19H,1,3-4,18H2 |
| InChIKey | JNFWBDGZWQVNBK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|