C14H14Br2N2O2S — CID 105302953
[(4,5-dibromothiophen-2-yl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methyl]hydrazine (PubChem CID 105302953) has the molecular formula C14H14Br2N2O2S and a molecular weight of 434.15 g/mol. Its IUPAC name is [(4,5-dibromothiophen-2-yl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methyl]hydrazine.
| Compound Name | [(4,5-dibromothiophen-2-yl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105302953 |
| Molecular Formula | C14H14Br2N2O2S |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | [(4,5-dibromothiophen-2-yl)-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)OCCCO2)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H14Br2N2O2S/c15-9-7-12(21-14(9)16)13(18-17)8-2-3-10-11(6-8)20-5-1-4-19-10/h2-3,6-7,13,18H,1,4-5,17H2 |
| InChIKey | AUSWGYKZFWVJBM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|