C17H22N2S — CID 105341956
[(3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methyl]hydrazine (PubChem CID 105341956) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is [(3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methyl]hydrazine.
| Compound Name | [(3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341956 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [(3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2cccc(C3CCC3)c2)sc1C |
| InChI | InChI=1S/C17H22N2S/c1-11-9-16(20-12(11)2)17(19-18)15-8-4-7-14(10-15)13-5-3-6-13/h4,7-10,13,17,19H,3,5-6,18H2,1-2H3 |
| InChIKey | USURPVLXIUEBAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|