C17H21NS — CID 105053790
(3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methanamine (PubChem CID 105053790) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methanamine.
| Compound Name | (3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105053790 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3-cyclobutylphenyl)-(4,5-dimethylthiophen-2-yl)methanamine |
| SMILES | Cc1cc(C(N)c2cccc(C3CCC3)c2)sc1C |
| InChI | InChI=1S/C17H21NS/c1-11-9-16(19-12(11)2)17(18)15-8-4-7-14(10-15)13-5-3-6-13/h4,7-10,13,17H,3,5-6,18H2,1-2H3 |
| InChIKey | HUCMIODXAAFPSG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |