C15H23N — CID 114602608
1-(3-cyclobutylphenyl)-2,2-dimethylpropan-1-amine (PubChem CID 114602608) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | 1-(3-cyclobutylphenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114602608 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C15H23N/c1-15(2,3)14(16)13-9-5-8-12(10-13)11-6-4-7-11/h5,8-11,14H,4,6-7,16H2,1-3H3 |
| InChIKey | YZYXHTPKRJUTDY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |