C12H13F3O — CID 104939857
(1R)-1-(3-cyclobutylphenyl)-2,2,2-trifluoroethanol (PubChem CID 104939857) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is (1R)-1-(3-cyclobutylphenyl)-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-(3-cyclobutylphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 104939857 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (1R)-1-(3-cyclobutylphenyl)-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1cccc(C2CCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O/c13-12(14,15)11(16)10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8,11,16H,1,3-4H2/t11-/m1/s1 |
| InChIKey | PJVILCWXOBYFNE-LLVKDONJSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |