C15H18F4O2 — CID 103474035
1-(3-cyclobutylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103474035) has the molecular formula C15H18F4O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(3-cyclobutylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103474035 |
| Molecular Formula | C15H18F4O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | OC(COCC(F)(F)C(F)F)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C15H18F4O2/c16-14(17)15(18,19)9-21-8-13(20)12-6-2-5-11(7-12)10-3-1-4-10/h2,5-7,10,13-14,20H,1,3-4,8-9H2 |
| InChIKey | GKDYVDKXXIAHAM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|