C15H15Br2NS — CID 105053621
(3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methanamine (PubChem CID 105053621) has the molecular formula C15H15Br2NS and a molecular weight of 401.17 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methanamine.
| Compound Name | (3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105053621 |
| Molecular Formula | C15H15Br2NS |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | (3-cyclobutylphenyl)-(4,5-dibromothiophen-2-yl)methanamine |
| SMILES | NC(c1cccc(C2CCC2)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H15Br2NS/c16-12-8-13(19-15(12)17)14(18)11-6-2-5-10(7-11)9-3-1-4-9/h2,5-9,14H,1,3-4,18H2 |
| InChIKey | CDXAGALGWJMLPP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |