C13H20N2 — CID 105163949
1-(2,6-dimethyl-3-pyridinyl)-3-methylidenepentan-1-amine (PubChem CID 105163949) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)-3-methylidenepentan-1-amine.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 105163949 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)-3-methylidenepentan-1-amine |
| SMILES | C=C(CC)CC(N)c1ccc(C)nc1C |
| InChI | InChI=1S/C13H20N2/c1-5-9(2)8-13(14)12-7-6-10(3)15-11(12)4/h6-7,13H,2,5,8,14H2,1,3-4H3 |
| InChIKey | SNTLLQIZHIIUKR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|