C28H36O7 — CID 163186295
[(1R,3S)-3-[(E)-5-(6,8-dimethoxy-2-oxochromen-7-yl)oxy-3-methylpent-3-enyl]-2,2-dimethyl-4-methylidenecyclohexyl] acetate (PubChem CID 163186295) has the molecular formula C28H36O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(1R,3S)-3-[(E)-5-(6,8-dimethoxy-2-oxochromen-7-yl)oxy-3-methylpent-3-enyl]-2,2-dimethyl-4-methylidenecyclohexyl] acetate.
| Compound Name | [(1R,3S)-3-[(E)-5-(6,8-dimethoxy-2-oxochromen-7-yl)oxy-3-methylpent-3-enyl]-2,2-dimethyl-4-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 163186295 |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [(1R,3S)-3-[(E)-5-(6,8-dimethoxy-2-oxochromen-7-yl)oxy-3-methylpent-3-enyl]-2,2-dimethyl-4-methylidenecyclohexyl] acetate |
| SMILES | C=C1CC[C@@H](OC(C)=O)C(C)(C)[C@H]1CC/C(C)=C/COc1c(OC)cc2ccc(=O)oc2c1OC |
| InChI | InChI=1S/C28H36O7/c1-17(8-11-21-18(2)9-12-23(28(21,4)5)34-19(3)29)14-15-33-26-22(31-6)16-20-10-13-24(30)35-25(20)27(26)32-7/h10,13-14,16,21,23H,2,8-9,11-12,15H2,1,3-7H3/b17-14+/t21-,23+/m0/s1 |
| InChIKey | AKTDQXVHGDYJRE-IWZROUJUSA-N |
| XLogP | 5.84 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|