C26H36O6 — CID 163189592
7-[[(1S,2S,6S)-2-(3-hydroxypropyl)-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-6,8-dimethoxychromen-2-one (PubChem CID 163189592) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 7-[[(1S,2S,6S)-2-(3-hydroxypropyl)-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-6,8-dimethoxychromen-2-one.
| Compound Name | 7-[[(1S,2S,6S)-2-(3-hydroxypropyl)-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-6,8-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 163189592 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 7-[[(1S,2S,6S)-2-(3-hydroxypropyl)-1,6-dimethyl-3-propan-2-ylidenecyclohexyl]methoxy]-6,8-dimethoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c(OC)c1OC[C@@]1(C)[C@@H](C)CCC(=C(C)C)[C@@H]1CCCO |
| InChI | InChI=1S/C26H36O6/c1-16(2)19-11-9-17(3)26(4,20(19)8-7-13-27)15-31-24-21(29-5)14-18-10-12-22(28)32-23(18)25(24)30-6/h10,12,14,17,20,27H,7-9,11,13,15H2,1-6H3/t17-,20-,26-/m0/s1 |
| InChIKey | WXHHBGCLCGHPLX-SZCFDOLESA-N |
| XLogP | 5.35 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|