C26H32O6 — CID 162863758
7-[(2,5,5,8a-tetramethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one (PubChem CID 162863758) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 7-[(2,5,5,8a-tetramethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one.
| Compound Name | 7-[(2,5,5,8a-tetramethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 162863758 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 7-[(2,5,5,8a-tetramethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c(OC)c1OCC1C(C)=CCC2C(C)(C)C(=O)CCC12C |
| InChI | InChI=1S/C26H32O6/c1-15-7-9-19-25(2,3)20(27)11-12-26(19,4)17(15)14-31-23-18(29-5)13-16-8-10-21(28)32-22(16)24(23)30-6/h7-8,10,13,17,19H,9,11-12,14H2,1-6H3 |
| InChIKey | NROVJRZLUVIXRD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|