C20H20N2O4 — CID 87812173
9-methoxyfuro[3,2-g]chromen-7-one;2-phenylethylhydrazine (PubChem CID 87812173) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 9-methoxyfuro[3,2-g]chromen-7-one;2-phenylethylhydrazine.
| Compound Name | 9-methoxyfuro[3,2-g]chromen-7-one;2-phenylethylhydrazine |
|---|---|
| PubChem CID | 87812173 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 9-methoxyfuro[3,2-g]chromen-7-one;2-phenylethylhydrazine |
| SMILES | COc1c2occc2cc2ccc(=O)oc12.NNCCc1ccccc1 |
| InChI | InChI=1S/C12H8O4.C8H12N2/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12;9-10-7-6-8-4-2-1-3-5-8/h2-6H,1H3;1-5,10H,6-7,9H2 |
| InChIKey | VKFZLLRZCPVHNV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|