C17H17ClO6 — CID 163042488
9-[(2S)-3-chloro-2-hydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 163042488) has the molecular formula C17H17ClO6 and a molecular weight of 352.77 g/mol. Its IUPAC name is 9-[(2S)-3-chloro-2-hydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 9-[(2S)-3-chloro-2-hydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 163042488 |
| Molecular Formula | C17H17ClO6 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 9-[(2S)-3-chloro-2-hydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2c(OC[C@H](O)C(C)(C)Cl)c2oc(=O)ccc12 |
| InChI | InChI=1S/C17H17ClO6/c1-17(2,18)11(19)8-23-16-14-10(6-7-22-14)13(21-3)9-4-5-12(20)24-15(9)16/h4-7,11,19H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | FAYBWXRPYVVJAY-NSHDSACASA-N |
| XLogP | 3.30 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|