C15H14ClNO4 — CID 54397963
4-[[chloromethyl(methyl)amino]methyl]-9-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 54397963) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 4-[[chloromethyl(methyl)amino]methyl]-9-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 4-[[chloromethyl(methyl)amino]methyl]-9-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 54397963 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-[[chloromethyl(methyl)amino]methyl]-9-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2occc2c(CN(C)CCl)c2ccc(=O)oc12 |
| InChI | InChI=1S/C15H14ClNO4/c1-17(8-16)7-11-9-3-4-12(18)21-14(9)15(19-2)13-10(11)5-6-20-13/h3-6H,7-8H2,1-2H3 |
| InChIKey | VLJCONORASCWLL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|