C21H13NO6 — CID 13436377
2-[(4-methoxy-7-oxofuro[3,2-g]chromen-9-yl)methyl]isoindole-1,3-dione (PubChem CID 13436377) has the molecular formula C21H13NO6 and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-[(4-methoxy-7-oxofuro[3,2-g]chromen-9-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-methoxy-7-oxofuro[3,2-g]chromen-9-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13436377 |
| Molecular Formula | C21H13NO6 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-[(4-methoxy-7-oxofuro[3,2-g]chromen-9-yl)methyl]isoindole-1,3-dione |
| SMILES | COc1c2ccoc2c(CN2C(=O)c3ccccc3C2=O)c2oc(=O)ccc12 |
| InChI | InChI=1S/C21H13NO6/c1-26-17-13-6-7-16(23)28-19(13)15(18-14(17)8-9-27-18)10-22-20(24)11-4-2-3-5-12(11)21(22)25/h2-9H,10H2,1H3 |
| InChIKey | UGSRZYKTVDFCOK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|