C22H15NO5 — CID 19904839
5-methyl-2-[(5-methyl-2-oxofuro[2,3-h]chromen-6-yl)methyl]isoindole-1,3-dione (PubChem CID 19904839) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is 5-methyl-2-[(5-methyl-2-oxofuro[2,3-h]chromen-6-yl)methyl]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-[(5-methyl-2-oxofuro[2,3-h]chromen-6-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19904839 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-methyl-2-[(5-methyl-2-oxofuro[2,3-h]chromen-6-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(Cc1c(C)c3ccc(=O)oc3c3ccoc13)C2=O |
| InChI | InChI=1S/C22H15NO5/c1-11-3-4-14-16(9-11)22(26)23(21(14)25)10-17-12(2)13-5-6-18(24)28-20(13)15-7-8-27-19(15)17/h3-9H,10H2,1-2H3 |
| InChIKey | GZCIULZKECTYAY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|