C23H17NO5 — CID 18421421
2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)methyl]isoindole-1,3-dione (PubChem CID 18421421) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18421421 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1cc2cc3c(C)c(CN4C(=O)c5ccccc5C4=O)c(=O)oc3c(C)c2o1 |
| InChI | InChI=1S/C23H17NO5/c1-11-8-14-9-17-12(2)18(23(27)29-20(17)13(3)19(14)28-11)10-24-21(25)15-6-4-5-7-16(15)22(24)26/h4-9H,10H2,1-3H3 |
| InChIKey | ZLFNLQDBKCSNBG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|