C14H9ClO4 — CID 15749397
3-chloro-4,10-dimethylpyrano[3,2-g]chromene-2,8-dione (PubChem CID 15749397) has the molecular formula C14H9ClO4 and a molecular weight of 276.68 g/mol. Its IUPAC name is 3-chloro-4,10-dimethylpyrano[3,2-g]chromene-2,8-dione.
| Compound Name | 3-chloro-4,10-dimethylpyrano[3,2-g]chromene-2,8-dione |
|---|---|
| PubChem CID | 15749397 |
| Molecular Formula | C14H9ClO4 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-chloro-4,10-dimethylpyrano[3,2-g]chromene-2,8-dione |
| SMILES | Cc1c(Cl)c(=O)oc2c(C)c3oc(=O)ccc3cc12 |
| InChI | InChI=1S/C14H9ClO4/c1-6-9-5-8-3-4-10(16)18-12(8)7(2)13(9)19-14(17)11(6)15/h3-5H,1-2H3 |
| InChIKey | RGUQQGWTUMISBN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|