C20H15ClO3 — CID 122537825
2-(chloromethyl)-3,9-dimethyl-5-phenylfuro[3,2-g]chromen-7-one (PubChem CID 122537825) has the molecular formula C20H15ClO3 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-(chloromethyl)-3,9-dimethyl-5-phenylfuro[3,2-g]chromen-7-one.
| Compound Name | 2-(chloromethyl)-3,9-dimethyl-5-phenylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 122537825 |
| Molecular Formula | C20H15ClO3 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-(chloromethyl)-3,9-dimethyl-5-phenylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1c(CCl)oc2c(C)c3oc(=O)cc(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C20H15ClO3/c1-11-14-8-16-15(13-6-4-3-5-7-13)9-18(22)24-20(16)12(2)19(14)23-17(11)10-21/h3-9H,10H2,1-2H3 |
| InChIKey | RGJYYSICBALPPL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|