C15H14O4 — CID 18612305
2-(hydroxymethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 18612305) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 2-(hydroxymethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 18612305 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(hydroxymethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1cc(=O)oc2c(C)c3oc(CO)c(C)c3cc12 |
| InChI | InChI=1S/C15H14O4/c1-7-4-13(17)19-14-9(3)15-11(5-10(7)14)8(2)12(6-16)18-15/h4-5,16H,6H2,1-3H3 |
| InChIKey | ASNFMRDJIIYCDP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|