C15H15NO3 — CID 46883450
8-(hydroxymethyl)-4,6,9-trimethyl-1H-furo[2,3-h]quinolin-2-one (PubChem CID 46883450) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 8-(hydroxymethyl)-4,6,9-trimethyl-1H-furo[2,3-h]quinolin-2-one.
| Compound Name | 8-(hydroxymethyl)-4,6,9-trimethyl-1H-furo[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 46883450 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 8-(hydroxymethyl)-4,6,9-trimethyl-1H-furo[2,3-h]quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2c1cc(C)c1oc(CO)c(C)c12 |
| InChI | InChI=1S/C15H15NO3/c1-7-5-12(18)16-14-10(7)4-8(2)15-13(14)9(3)11(6-17)19-15/h4-5,17H,6H2,1-3H3,(H,16,18) |
| InChIKey | RMPRKPVVCHNVCU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |