C13H11NO2 — CID 46883413
4,9-dimethyl-1H-furo[2,3-h]quinolin-2-one (PubChem CID 46883413) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4,9-dimethyl-1H-furo[2,3-h]quinolin-2-one.
| Compound Name | 4,9-dimethyl-1H-furo[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 46883413 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4,9-dimethyl-1H-furo[2,3-h]quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2c1ccc1occ(C)c12 |
| InChI | InChI=1S/C13H11NO2/c1-7-5-11(15)14-13-9(7)3-4-10-12(13)8(2)6-16-10/h3-6H,1-2H3,(H,14,15) |
| InChIKey | JRJTXYXUWWSNDP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |