About 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one
4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one (PubChem CID 46883414) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one |
| PubChem CID | 46883414 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one |
| SMILES | Cc1cc2c(o1)c(C)cc1c(CO)cc(=O)[nH]c12 |
| InChI | InChI=1S/C14H13NO3/c1-7-3-10-9(6-16)5-12(17)15-13(10)11-4-8(2)18-14(7)11/h3-5,16H,6H2,1-2H3,(H,15,17) |
| InChIKey | DEHPUURHPFTDSP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one?
The IUPAC name of 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one (CID 46883414) is 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one.
What is the SMILES notation for 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one?
The canonical SMILES for 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one is Cc1cc2c(o1)c(C)cc1c(CO)cc(=O)[nH]c12.
What is the InChIKey of 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one?
The InChIKey is DEHPUURHPFTDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-7-3-10-9(6-16)5-12(17)15-13(10)11-4-8(2)18-14(7)11/h3-5,16H,6H2,1-2H3,(H,15,17).
What are the key properties of 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one?
4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one has a molecular weight of 243.26 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-6,8-dimethyl-1H-furo[2,3-h]quinolin-2-one is sourced from PubChem (CID 46883414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).