C16H17NO3 — CID 10038822
4-(methoxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one (PubChem CID 10038822) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-(methoxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one.
| Compound Name | 4-(methoxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 10038822 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(methoxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one |
| SMILES | COCc1cc(=O)n(C)c2c1cc(C)c1oc(C)cc12 |
| InChI | InChI=1S/C16H17NO3/c1-9-5-12-11(8-19-4)7-14(18)17(3)15(12)13-6-10(2)20-16(9)13/h5-7H,8H2,1-4H3 |
| InChIKey | FZTVRRGUKPTLHQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |