C15H13ClO3 — CID 22889016
8-(chloromethyl)-4,6,9-trimethylfuro[2,3-h]chromen-2-one (PubChem CID 22889016) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 8-(chloromethyl)-4,6,9-trimethylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-(chloromethyl)-4,6,9-trimethylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 22889016 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 8-(chloromethyl)-4,6,9-trimethylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1cc(C)c1oc(CCl)c(C)c12 |
| InChI | InChI=1S/C15H13ClO3/c1-7-5-12(17)19-15-10(7)4-8(2)14-13(15)9(3)11(6-16)18-14/h4-5H,6H2,1-3H3 |
| InChIKey | AXRWBVNVYSXSFQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|