C13H9ClO3 — CID 102406727
6-chloro-4,9-dimethylfuro[2,3-h]chromen-2-one (PubChem CID 102406727) has the molecular formula C13H9ClO3 and a molecular weight of 248.66 g/mol. Its IUPAC name is 6-chloro-4,9-dimethylfuro[2,3-h]chromen-2-one.
| Compound Name | 6-chloro-4,9-dimethylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 102406727 |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 6-chloro-4,9-dimethylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1cc(Cl)c1occ(C)c12 |
| InChI | InChI=1S/C13H9ClO3/c1-6-3-10(15)17-12-8(6)4-9(14)13-11(12)7(2)5-16-13/h3-5H,1-2H3 |
| InChIKey | JBUKAMZNTSJQRO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|