C20H15ClN2O4 — CID 633348
N-[9-(4-chloroanilino)-4-methyl-2-oxofuro[2,3-h]chromen-6-yl]acetamide (PubChem CID 633348) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is N-[9-(4-chloroanilino)-4-methyl-2-oxofuro[2,3-h]chromen-6-yl]acetamide.
| Compound Name | N-[9-(4-chloroanilino)-4-methyl-2-oxofuro[2,3-h]chromen-6-yl]acetamide |
|---|---|
| PubChem CID | 633348 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[9-(4-chloroanilino)-4-methyl-2-oxofuro[2,3-h]chromen-6-yl]acetamide |
| SMILES | CC(=O)Nc1cc2c(C)cc(=O)oc2c2c(Nc3ccc(Cl)cc3)coc12 |
| InChI | InChI=1S/C20H15ClN2O4/c1-10-7-17(25)27-19-14(10)8-15(22-11(2)24)20-18(19)16(9-26-20)23-13-5-3-12(21)4-6-13/h3-9,23H,1-2H3,(H,22,24) |
| InChIKey | LLSGEXRGGGSGPJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|