C13H9NO4 — CID 618277
N-(4-methyl-2-oxofuro[2,3-h]chromen-6-yl)formamide (PubChem CID 618277) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is N-(4-methyl-2-oxofuro[2,3-h]chromen-6-yl)formamide.
| Compound Name | N-(4-methyl-2-oxofuro[2,3-h]chromen-6-yl)formamide |
|---|---|
| PubChem CID | 618277 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(4-methyl-2-oxofuro[2,3-h]chromen-6-yl)formamide |
| SMILES | Cc1cc(=O)oc2c1cc(NC=O)c1occc12 |
| InChI | InChI=1S/C13H9NO4/c1-7-4-11(16)18-12-8-2-3-17-13(8)10(14-6-15)5-9(7)12/h2-6H,1H3,(H,14,15) |
| InChIKey | PBZLKXQVBARLEQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|