C15H13ClO4 — CID 22915343
3-(chloromethyl)-9-methoxy-2,5-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 22915343) has the molecular formula C15H13ClO4 and a molecular weight of 292.72 g/mol. Its IUPAC name is 3-(chloromethyl)-9-methoxy-2,5-dimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-(chloromethyl)-9-methoxy-2,5-dimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 22915343 |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(chloromethyl)-9-methoxy-2,5-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2oc(=O)cc(C)c2cc2c(CCl)c(C)oc12 |
| InChI | InChI=1S/C15H13ClO4/c1-7-4-12(17)20-13-9(7)5-10-11(6-16)8(2)19-14(10)15(13)18-3/h4-5H,6H2,1-3H3 |
| InChIKey | BAJVTTYAASIKIU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|