C16H17NO3 — CID 59103381
3-(aminomethyl)-9-ethyl-2,5-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 59103381) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-(aminomethyl)-9-ethyl-2,5-dimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-(aminomethyl)-9-ethyl-2,5-dimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 59103381 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(aminomethyl)-9-ethyl-2,5-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | CCc1c2oc(=O)cc(C)c2cc2c(CN)c(C)oc12 |
| InChI | InChI=1S/C16H17NO3/c1-4-10-15-11(8(2)5-14(18)20-15)6-12-13(7-17)9(3)19-16(10)12/h5-6H,4,7,17H2,1-3H3 |
| InChIKey | CDGLWHRYJPRRQN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|