C19H23NO5 — CID 15461706
3-[2-(2-aminoethoxy)ethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 15461706) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-[2-(2-aminoethoxy)ethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 15461706 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1COCCOCCN |
| InChI | InChI=1S/C19H23NO5/c1-11-8-17(21)25-18-12(2)19-15(9-14(11)18)16(13(3)24-19)10-23-7-6-22-5-4-20/h8-9H,4-7,10,20H2,1-3H3 |
| InChIKey | UJZKJTNHMYJIJV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|