C20H24O8S — CID 23443465
2-[2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)methoxy]ethoxy]ethyl methanesulfonate (PubChem CID 23443465) has the molecular formula C20H24O8S and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-[2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)methoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)methoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 23443465 |
| Molecular Formula | C20H24O8S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-[2-[(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)methoxy]ethoxy]ethyl methanesulfonate |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1COCCOCCOS(C)(=O)=O |
| InChI | InChI=1S/C20H24O8S/c1-12-9-18(21)28-19-13(2)20-16(10-15(12)19)17(14(3)27-20)11-25-6-5-24-7-8-26-29(4,22)23/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | GJZYYUAJEOVURV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|