C17H18O5 — CID 18421417
9-(2-hydroxyethoxymethyl)-2,3,5-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 18421417) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 9-(2-hydroxyethoxymethyl)-2,3,5-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 9-(2-hydroxyethoxymethyl)-2,3,5-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 18421417 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 9-(2-hydroxyethoxymethyl)-2,3,5-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(COCCO)c3oc(=O)cc(C)c3cc2c1C |
| InChI | InChI=1S/C17H18O5/c1-9-6-15(19)22-16-12(9)7-13-10(2)11(3)21-17(13)14(16)8-20-5-4-18/h6-7,18H,4-5,8H2,1-3H3 |
| InChIKey | PWRVEXDKFOKAQG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|