C17H18O4 — CID 1239680
2-[(1R)-1-methoxyethyl]-3,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 1239680) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[(1R)-1-methoxyethyl]-3,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 2-[(1R)-1-methoxyethyl]-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 1239680 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[(1R)-1-methoxyethyl]-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | CO[C@H](C)c1oc2c(C)c3oc(=O)cc(C)c3cc2c1C |
| InChI | InChI=1S/C17H18O4/c1-8-6-14(18)20-16-10(3)17-13(7-12(8)16)9(2)15(21-17)11(4)19-5/h6-7,11H,1-5H3/t11-/m1/s1 |
| InChIKey | JFSRDKGQQWQUPR-LLVKDONJSA-N |
| XLogP | 4.17 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|