C26H20O4 — CID 7273664
2-[(S)-hydroxy(phenyl)methyl]-5,9-dimethyl-3-phenylfuro[3,2-g]chromen-7-one (PubChem CID 7273664) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[(S)-hydroxy(phenyl)methyl]-5,9-dimethyl-3-phenylfuro[3,2-g]chromen-7-one.
| Compound Name | 2-[(S)-hydroxy(phenyl)methyl]-5,9-dimethyl-3-phenylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 7273664 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[(S)-hydroxy(phenyl)methyl]-5,9-dimethyl-3-phenylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1cc(=O)oc2c(C)c3oc([C@@H](O)c4ccccc4)c(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C26H20O4/c1-15-13-21(27)29-24-16(2)25-20(14-19(15)24)22(17-9-5-3-6-10-17)26(30-25)23(28)18-11-7-4-8-12-18/h3-14,23,28H,1-2H3/t23-/m0/s1 |
| InChIKey | BCSZGUYBTBKQKG-QHCPKHFHSA-N |
| XLogP | 5.90 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|