C26H28N2O3 — CID 59939080
3-[(4-benzylpiperazin-1-yl)methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 59939080) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[(4-benzylpiperazin-1-yl)methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-[(4-benzylpiperazin-1-yl)methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 59939080 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-[(4-benzylpiperazin-1-yl)methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N2O3/c1-17-13-24(29)31-25-18(2)26-22(14-21(17)25)23(19(3)30-26)16-28-11-9-27(10-12-28)15-20-7-5-4-6-8-20/h4-8,13-14H,9-12,15-16H2,1-3H3 |
| InChIKey | MZQUVBLUBFHTKV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|